Compound Q&A

What precautions should be taken when handling 3-(4-Chloro-3-fluorophenyl)acrylic acid (CAS: 202982-66-9)?

Answer

3-(4-Chloro-3-fluorophenyl)acrylic acid
When handling 3-(4-Chloro-3-fluorophenyl)acrylic acid, it is important to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. The compound should be handled in a well-ventilated area or a fume hood to avoid inhalation of fumes. In case of a spill, it should be carefully cleaned up using appropriate absorbents. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

English Name 3-(4-Chloro-3-fluorophenyl)acrylic acid
Molecular Formula C9H6ClFO2
Molecular Weight 200.6 g/mol
SMILES C1=CC(=C(C=C1C=CC(=O)O)F)Cl
InChIKey MNELKRQRBRYHBV-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(4-Chloro-3-fluorophenyl)acrylic acid (CAS: 202982-66-9)?

3-(4-Chloro-3-fluorophenyl)acrylic acid is a white crystalline solid with a molecular weight of appr...

Compound Q&A

How is 3-(4-Chloro-3-fluorophenyl)acrylic acid (CAS: 202982-66-9) typically synthesized?

3-(4-Chloro-3-fluorophenyl)acrylic acid is usually synthesized through the reaction of 3-(4-chloro-3...

Compound Q&A

What industries use 3-(4-Chloro-3-fluorophenyl)acrylic acid (CAS: 202982-66-9)?

3-(4-Chloro-3-fluorophenyl)acrylic acid is primarily used in the pharmaceutical and polymer industri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...