Compound Q&A

What are the physical and chemical properties of 3-(4-Chloro-3-fluorophenyl)acrylic acid (CAS: 202982-66-9)?

Answer

3-(4-Chloro-3-fluorophenyl)acrylic acid
3-(4-Chloro-3-fluorophenyl)acrylic acid is a white crystalline solid with a molecular weight of approximately 246.03 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and methanol. The compound is known for its reactivity, particularly in nucleophilic substitution reactions. It can also undergo polymerization and other organic transformations under certain conditions.

About

English Name 3-(4-Chloro-3-fluorophenyl)acrylic acid
Molecular Formula C9H6ClFO2
Molecular Weight 200.6 g/mol
SMILES C1=CC(=C(C=C1C=CC(=O)O)F)Cl
InChIKey MNELKRQRBRYHBV-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

How is 3-(4-Chloro-3-fluorophenyl)acrylic acid (CAS: 202982-66-9) typically synthesized?

3-(4-Chloro-3-fluorophenyl)acrylic acid is usually synthesized through the reaction of 3-(4-chloro-3...

Compound Q&A

What industries use 3-(4-Chloro-3-fluorophenyl)acrylic acid (CAS: 202982-66-9)?

3-(4-Chloro-3-fluorophenyl)acrylic acid is primarily used in the pharmaceutical and polymer industri...

Compound Q&A

What precautions should be taken when handling 3-(4-Chloro-3-fluorophenyl)acrylic acid (CAS: 202982-66-9)?

When handling 3-(4-Chloro-3-fluorophenyl)acrylic acid, it is important to wear appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...