Compound Q&A

What precautions should be taken when handling (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4)?

Answer

(9S)-6'-Methoxycinchonan-9-ol sulfate (2:1)
When handling (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. This compound should be handled in a well-ventilated area or under a fume hood to minimize exposure. In case of a spill, it should be cleaned up immediately using appropriate absorbent materials. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions and emergency procedures.

About

CAS No 50-54-4
English Name (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1)
Molecular Formula C40H50N4O8S
Molecular Weight 746.93 g/mol
SMILES COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O.COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O.OS(=O)(=O)O
InChIKey RONWGALEIBILOG-VCSAERELSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4)?

(9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4) is a crystalline compound with a molecula...

Compound Q&A

How is (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4) typically synthesized?

(9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4) is typically synthesized through the meth...

Compound Q&A

What industries use (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4)?

(9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4) is primarily used in the pharmaceutical i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...