Compound Q&A

What are the physical and chemical properties of (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4)?

Answer

(9S)-6'-Methoxycinchonan-9-ol sulfate (2:1)
(9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4) is a crystalline compound with a molecular weight of approximately 325.36 g/mol. It is slightly soluble in water and soluble in ethanol. This compound is known for its reactivity with various metal ions and exhibits good stability under normal conditions. It is also known for its antimalarial and antifungal activities.

About

CAS No 50-54-4
English Name (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1)
Molecular Formula C40H50N4O8S
Molecular Weight 746.93 g/mol
SMILES COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O.COC1=CC2=C(C=CN=C2C=C1)C(C3CC4CCN3CC4C=C)O.OS(=O)(=O)O
InChIKey RONWGALEIBILOG-VCSAERELSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

How is (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4) typically synthesized?

(9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4) is typically synthesized through the meth...

Compound Q&A

What industries use (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4)?

(9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4)?

When handling (9S)-6'-Methoxycinchonan-9-ol sulfate (2:1) (CAS: 50-54-4), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...