Compound Q&A

What are the physical and chemical properties of 3-Hydroxy-2-naphthamide (CAS: 3665-51-8)?

Answer

3-Hydroxy-2-naphthamide
3-Hydroxy-2-naphthamide (CAS: 3665-51-8) is a crystalline compound with a molecular weight of approximately 186.18 g/mol. It has a pKa around 9.8, indicating basic properties. The compound is poorly soluble in water but soluble in organic solvents like ethanol and acetone. It is not highly reactive but can undergo substitution reactions under certain conditions. It has a melting point of about 220-222°C.

About

CAS No 3665-51-8
English Name 3-Hydroxy-2-naphthamide
Molecular Formula C11H9NO2
Molecular Weight 187.2 g/mol
SMILES C1=CC=C2C=C(C(=CC2=C1)C(=O)N)O
InChIKey NFTNTGFZYSCPSK-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 3-Hydroxy-2-naphthamide (CAS: 3665-51-8) typically synthesized?

3-Hydroxy-2-naphthamide can be synthesized via a multi-step process involving the condensation of 2-...

Compound Q&A

What industries use 3-Hydroxy-2-naphthamide (CAS: 3665-51-8)?

3-Hydroxy-2-naphthamide (CAS: 3665-51-8) is used in various industries, particularly in the pharmace...

Compound Q&A

What precautions should be taken when handling 3-Hydroxy-2-naphthamide (CAS: 3665-51-8)?

When handling 3-Hydroxy-2-naphthamide (CAS: 3665-51-8), appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...