Compound Q&A

What precautions should be taken when handling 6-Bromo-2(1H)-quinazolinone (CAS: 79885-37-3)?

Answer

6-Bromo-2(1H)-quinazolinone
When handling 6-Bromo-2(1H)-quinazolinone (CAS: 79885-37-3), it is essential to use appropriate personal protective equipment (PPE), such as gloves, safety goggles, and a lab coat. The substance should be stored in a cool, dry place away from direct sunlight and heat sources. In case of a spill, it should be handled in a well-ventilated area with the use of appropriate containment equipment, and spills should be cleaned up immediately following the manufacturer’s safety guidelines and emergency procedures. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

CAS No 79885-37-3
English Name 6-Bromo-2(1H)-quinazolinone
Molecular Formula C8H5BrN2O
Molecular Weight 225.05 g/mol
SMILES C1=CC2=C(C=C1Br)C=NC(=O)N2
InChIKey HNUYWQSBQPNNOB-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-2(1H)-quinazolinone (CAS: 79885-37-3)?

6-Bromo-2(1H)-quinazolinone is a crystalline solid with a molecular weight of approximately 220.03 g...

Compound Q&A

How is 6-Bromo-2(1H)-quinazolinone (CAS: 79885-37-3) typically synthesized?

6-Bromo-2(1H)-quinazolinone is typically synthesized through the bromination of 2(1H)-quinazolinone....

Compound Q&A

What industries use 6-Bromo-2(1H)-quinazolinone (CAS: 79885-37-3)?

6-Bromo-2(1H)-quinazolinone finds applications in various industries, including pharmaceuticals, whe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...