Compound Q&A

What industries use Methyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate hydrochloride (CAS: 78183-55-8)?

Answer

Methyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate hydrochloride (1:1)
Methyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate hydrochloride is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds application in the production of various organic compounds and as a reagent in chemical research. Additionally, it can be used in the development of sensors and as a component in some polymer formulations.

About

CAS No 78183-55-8
English Name Methyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate hydrochloride (1:1)
Molecular Formula C11H14ClNO2
Molecular Weight 227.69 g/mol
SMILES COC(=O)C1CC2=CC=CC=C2CN1.Cl
InChIKey BUXCBOUGBHWQBE-PPHPATTJSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate hydrochloride (CAS: 78183-55-8)?

Methyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate hydrochloride is a white crystalline solid ...

Compound Q&A

How is Methyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate hydrochloride (CAS: 78183-55-8) typically synthesized?

Methyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate hydrochloride is synthesized through a mult...

Compound Q&A

What precautions should be taken when handling Methyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate hydrochloride (CAS: 78183-55-8)?

When handling Methyl (3S)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate hydrochloride, it is importan...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...