Compound Q&A

How is Benzyl D-phenylalaninate hydrochloride (CAS: 87004-78-2) typically synthesized?

Answer

Benzyl D-phenylalaninate hydrochloride (1:1)
Benzyl D-phenylalaninate hydrochloride is typically synthesized by the amidation of benzyl D-phenylalanine with hydrochloric acid. The reaction is catalyzed by a mild base under mild conditions, yielding high selectivity and good yield. The process involves careful control of pH and temperature to achieve optimal reaction conditions.

About

CAS No 87004-78-2
English Name Benzyl D-phenylalaninate hydrochloride (1:1)
Molecular Formula C16H18ClNO2
Molecular Weight 291.77799999999996 g/mol
SMILES O=C([C@@H](CC1=CC=CC=C1)N)OCC2=CC=CC=C2.[H]Cl
InChIKey CEXFHIYDTRNBJD-XFULWGLBSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl D-phenylalaninate hydrochloride (CAS: 87004-78-2)?

Benzyl D-phenylalaninate hydrochloride is a white crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use Benzyl D-phenylalaninate hydrochloride (CAS: 87004-78-2)?

Benzyl D-phenylalaninate hydrochloride is used in various industries such as pharmaceuticals for the...

Compound Q&A

What precautions should be taken when handling Benzyl D-phenylalaninate hydrochloride (CAS: 87004-78-2)?

Proper personal protective equipment (PPE) such as safety goggles and gloves should be worn when han...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA