Compound Q&A

How is 1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9) typically synthesized?

Answer

1-(Azidomethyl)-4-methoxybenzene
1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9) is typically synthesized via the azidation of 4-methoxybenzyl bromide in the presence of a base like potassium tert-butoxide. The reaction is generally conducted in an inert solvent such as THF or DMSO at low to moderate temperatures. The use of azide reagents in the presence of a suitable catalyst can enhance the selectivity and yield of the product, making the process efficient for industrial-scale production.

About

CAS No 70978-37-9
English Name 1-(Azidomethyl)-4-methoxybenzene
Molecular Formula C8H9N3O
Molecular Weight 163.18 g/mol
SMILES COC1=CC=C(C=C1)CN=[N+]=[N-]
InChIKey IAKGGJYLHBHSQD-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9)?

1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9) is a crystalline solid with a molecular weight of...

Compound Q&A

What industries use 1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9)?

1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9) finds applications in various industries. In phar...

Compound Q&A

What precautions should be taken when handling 1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9)?

When handling 1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9), it is crucial to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...