Compound Q&A

What are the physical and chemical properties of 1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9)?

Answer

1-(Azidomethyl)-4-methoxybenzene
1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9) is a crystalline solid with a molecular weight of approximately 186.13 g/mol. It has a pKa of about 11.1, indicating basic properties. This compound is moderately soluble in common organic solvents like ethanol and chloroform but is almost insoluble in water. Chemically, it reacts readily with reducing agents and can be used as a precursor in azide chemistry. Its reactivity is influenced by its azido group, making it suitable for functionalization reactions.

About

CAS No 70978-37-9
English Name 1-(Azidomethyl)-4-methoxybenzene
Molecular Formula C8H9N3O
Molecular Weight 163.18 g/mol
SMILES COC1=CC=C(C=C1)CN=[N+]=[N-]
InChIKey IAKGGJYLHBHSQD-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9) typically synthesized?

1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9) is typically synthesized via the azidation of 4-m...

Compound Q&A

What industries use 1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9)?

1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9) finds applications in various industries. In phar...

Compound Q&A

What precautions should be taken when handling 1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9)?

When handling 1-(Azidomethyl)-4-methoxybenzene (CAS: 70978-37-9), it is crucial to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...