Compound Q&A

How is Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9) typically synthesized?

Answer

Manganese(2+) di[(9Z)-9-octadecenoate]
Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9) is typically synthesized through a reaction between manganese(II) salts and 9-octadecenoyl chloride under controlled conditions. Commonly, a Lewis acid catalyst is used to enhance the reaction selectivity and yield. The process requires careful temperature and reagent concentration control to achieve high yields.

About

CAS No 23250-73-9
English Name Manganese(2+) di[(9Z)-9-octadecenoate]
Molecular Formula C36H66MnO4
Molecular Weight 617.8 g/mol
SMILES CCCCCCCCC=CCCCCCCCC(=O)[O-].CCCCCCCCC=CCCCCCCCC(=O)[O-].[Mn+2]
InChIKey XYXLRVFDLJOZJC-CVBJKYQLSA-L
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9)?

Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9) is a solid compound with a crystalline form...

Compound Q&A

What industries use Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9)?

Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9) is utilized in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9)?

When handling Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...