Compound Q&A

What are the physical and chemical properties of Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9)?

Answer

Manganese(2+) di[(9Z)-9-octadecenoate]
Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9) is a solid compound with a crystalline form. Its molecular weight is approximately 426.55 g/mol. This compound is poorly soluble in water but soluble in organic solvents. It exhibits moderate reactivity, particularly in acidic environments. It is used in various applications due to its unique electronic structure and properties.

About

CAS No 23250-73-9
English Name Manganese(2+) di[(9Z)-9-octadecenoate]
Molecular Formula C36H66MnO4
Molecular Weight 617.8 g/mol
SMILES CCCCCCCCC=CCCCCCCCC(=O)[O-].CCCCCCCCC=CCCCCCCCC(=O)[O-].[Mn+2]
InChIKey XYXLRVFDLJOZJC-CVBJKYQLSA-L
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9) typically synthesized?

Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9) is typically synthesized through a reaction...

Compound Q&A

What industries use Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9)?

Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9) is utilized in the pharmaceutical industry ...

Compound Q&A

What precautions should be taken when handling Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9)?

When handling Manganese(2+) di[(9Z)-9-octadecenoate] (CAS: 23250-73-9), it is essential to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...