Compound Q&A

What precautions should be taken when handling 9H-Carbazol-9-ol (CAS: 54989-33-2)?

Answer

9H-Carbazol-9-ol
When handling 9H-Carbazol-9-ol, it is essential to use proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbents, and the material safety data sheet (MSDS) should be consulted for detailed emergency procedures.

About

CAS No 54989-33-2
English Name 9H-Carbazol-9-ol
Molecular Formula C12H9NO
Molecular Weight 183.21 g/mol
EINECS 258-034-9
SMILES C1=CC=C2C(=C1)C3=CC=CC=C3N2O
InChIKey PWERSDAXNCUOIB-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9H-Carbazol-9-ol (CAS: 54989-33-2)?

9H-Carbazol-9-ol is a solid at room temperature, with a molecular weight of approximately 145.16 g/m...

Compound Q&A

How is 9H-Carbazol-9-ol (CAS: 54989-33-2) typically synthesized?

9H-Carbazol-9-ol is commonly synthesized from 9H-carbazole-9-carboxylic acid via reduction using sod...

Compound Q&A

What industries use 9H-Carbazol-9-ol (CAS: 54989-33-2)?

9H-Carbazol-9-ol finds applications in the pharmaceutical industry, as a precursor for the synthesis...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...