Compound Q&A

What are the physical and chemical properties of 9H-Carbazol-9-ol (CAS: 54989-33-2)?

Answer

9H-Carbazol-9-ol
9H-Carbazol-9-ol is a solid at room temperature, with a molecular weight of approximately 145.16 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and dichloromethane. This compound shows limited reactivity; it can undergo electrophilic substitution reactions and can be used as a precursor in the synthesis of various carbazoles and derivatives.

About

CAS No 54989-33-2
English Name 9H-Carbazol-9-ol
Molecular Formula C12H9NO
Molecular Weight 183.21 g/mol
EINECS 258-034-9
SMILES C1=CC=C2C(=C1)C3=CC=CC=C3N2O
InChIKey PWERSDAXNCUOIB-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 9H-Carbazol-9-ol (CAS: 54989-33-2) typically synthesized?

9H-Carbazol-9-ol is commonly synthesized from 9H-carbazole-9-carboxylic acid via reduction using sod...

Compound Q&A

What industries use 9H-Carbazol-9-ol (CAS: 54989-33-2)?

9H-Carbazol-9-ol finds applications in the pharmaceutical industry, as a precursor for the synthesis...

Compound Q&A

What precautions should be taken when handling 9H-Carbazol-9-ol (CAS: 54989-33-2)?

When handling 9H-Carbazol-9-ol, it is essential to use proper personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...