Compound Q&A

What industries use 1H-Indol-3-yl beta-D-glucopyranosiduronic acid (CAS: 35804-66-1)?

Answer

1H-Indol-3-yl beta-D-glucopyranosiduronic acid
1H-Indol-3-yl beta-D-glucopyranosiduronic acid finds applications in the pharmaceutical industry, particularly in the development of novel drug candidates. It may also be used in the field of biotechnology for the synthesis of glycosaminoglycans and in food science as a natural sugar derivative. Its unique structure makes it suitable for use in sensor technology and as a building block in the synthesis of new materials.

About

CAS No 35804-66-1
English Name 1H-Indol-3-yl beta-D-glucopyranosiduronic acid
Molecular Formula C14H15NO7
Molecular Weight 309.27 g/mol
SMILES C1=CC=C2C(=C1)C(=CN2)OC3C(C(C(C(O3)C(=O)O)O)O)O
InChIKey KUYNOZVWCFXSNE-BYNIDDHOSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1H-Indol-3-yl beta-D-glucopyranosiduronic acid (CAS: 35804-66-1)?

1H-Indol-3-yl beta-D-glucopyranosiduronic acid is a crystalline compound with a molecular weight of ...

Compound Q&A

How is 1H-Indol-3-yl beta-D-glucopyranosiduronic acid (CAS: 35804-66-1) typically synthesized?

1H-Indol-3-yl beta-D-glucopyranosiduronic acid is typically synthesized through a multi-step process...

Compound Q&A

What precautions should be taken when handling 1H-Indol-3-yl beta-D-glucopyranosiduronic acid (CAS: 35804-66-1)?

When handling 1H-Indol-3-yl beta-D-glucopyranosiduronic acid, it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...