Compound Q&A

How is 1H-Indol-3-yl beta-D-glucopyranosiduronic acid (CAS: 35804-66-1) typically synthesized?

Answer

1H-Indol-3-yl beta-D-glucopyranosiduronic acid
1H-Indol-3-yl beta-D-glucopyranosiduronic acid is typically synthesized through a multi-step process involving the coupling of indole and glucose derivatives. Commonly, a catalytic amount of a metal catalyst such as palladium or ruthenium is used to facilitate the reaction. The selectivity and yield of the synthesis can be improved by optimizing reaction conditions such as temperature, solvent, and catalyst choice.

About

CAS No 35804-66-1
English Name 1H-Indol-3-yl beta-D-glucopyranosiduronic acid
Molecular Formula C14H15NO7
Molecular Weight 309.27 g/mol
SMILES C1=CC=C2C(=C1)C(=CN2)OC3C(C(C(C(O3)C(=O)O)O)O)O
InChIKey KUYNOZVWCFXSNE-BYNIDDHOSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1H-Indol-3-yl beta-D-glucopyranosiduronic acid (CAS: 35804-66-1)?

1H-Indol-3-yl beta-D-glucopyranosiduronic acid is a crystalline compound with a molecular weight of ...

Compound Q&A

What industries use 1H-Indol-3-yl beta-D-glucopyranosiduronic acid (CAS: 35804-66-1)?

1H-Indol-3-yl beta-D-glucopyranosiduronic acid finds applications in the pharmaceutical industry, pa...

Compound Q&A

What precautions should be taken when handling 1H-Indol-3-yl beta-D-glucopyranosiduronic acid (CAS: 35804-66-1)?

When handling 1H-Indol-3-yl beta-D-glucopyranosiduronic acid, it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...