Compound Q&A

What industries use (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5)?

Answer

(1,10-Phenanthroline)(trifluoromethyl) copper
(1,10-Phenanthroline)(trifluoromethyl) copper finds applications in various industries, particularly in catalysis and materials science. It is utilized in pharmaceuticals for its catalytic properties, in polymers for improving the mechanical properties, in sensors for its ability to detect specific chemical species, and in semiconductors for electronic applications due to its redox behavior.

About

English Name (1,10-Phenanthroline)(trifluoromethyl) copper
Molecular Formula C13H8CuF3N2
Molecular Weight 312.7610000000001 g/mol
SMILES C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.[C-](F)(F)F.[Cu+]
InChIKey CUQZQRIIFNWQSJ-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5)?

(1,10-Phenanthroline)(trifluoromethyl) copper is a coordination compound with a molecular weight of ...

Compound Q&A

How is (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5) typically synthesized?

(1,10-Phenanthroline)(trifluoromethyl) copper can be synthesized through a multistep process involvi...

Compound Q&A

What precautions should be taken when handling (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5)?

When handling (1,10-Phenanthroline)(trifluoromethyl) copper, it is essential to use appropriate pers...

Compound Q&A

What are the main uses of Ethyl N-2-pyridinyl-beta-alaninate (CAS: 103041-38-9)?

Ethyl N-2-pyridinyl-beta-alaninate is primarily used in the pharmaceutical indus...

103041-38-9Ethyl N-2-pyridinyl-...
Compound Q&A

Are there alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1) in synthesis?

There are alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1)...

1211584-54-15H-pyrrolo[3,4-b]pyr...
Compound Q&A

What industries use 2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride (CAS: 1353945-59-1)?

2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride is used in the pha...

1353945-59-12-{[(4-Chlorophenyl)...
Compound Q&A

How should Caesium chloride (CAS: 7647-17-8) be stored?

Caesium chloride should be stored in a cool, dry place (ideally 20-25°C), away f...

7647-17-8Caesium chloride