Compound Q&A

What are the physical and chemical properties of (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5)?

Answer

(1,10-Phenanthroline)(trifluoromethyl) copper
(1,10-Phenanthroline)(trifluoromethyl) copper is a coordination compound with a molecular weight of approximately 412.18 g/mol. It has good solubility in organic solvents but limited solubility in water. Chemically, it is known for its stability in aqueous solutions and its reactivity in catalytic processes, particularly in the presence of transition metals. It forms a crystalline structure and exhibits reddish-brown color in solid form.

About

English Name (1,10-Phenanthroline)(trifluoromethyl) copper
Molecular Formula C13H8CuF3N2
Molecular Weight 312.7610000000001 g/mol
SMILES C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.[C-](F)(F)F.[Cu+]
InChIKey CUQZQRIIFNWQSJ-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5) typically synthesized?

(1,10-Phenanthroline)(trifluoromethyl) copper can be synthesized through a multistep process involvi...

Compound Q&A

What industries use (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5)?

(1,10-Phenanthroline)(trifluoromethyl) copper finds applications in various industries, particularly...

Compound Q&A

What precautions should be taken when handling (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5)?

When handling (1,10-Phenanthroline)(trifluoromethyl) copper, it is essential to use appropriate pers...

Compound Q&A

What are the main uses of Ethyl N-2-pyridinyl-beta-alaninate (CAS: 103041-38-9)?

Ethyl N-2-pyridinyl-beta-alaninate is primarily used in the pharmaceutical indus...

103041-38-9Ethyl N-2-pyridinyl-...
Compound Q&A

Are there alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1) in synthesis?

There are alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1)...

1211584-54-15H-pyrrolo[3,4-b]pyr...
Compound Q&A

What industries use 2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride (CAS: 1353945-59-1)?

2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride is used in the pha...

1353945-59-12-{[(4-Chlorophenyl)...
Compound Q&A

How should Caesium chloride (CAS: 7647-17-8) be stored?

Caesium chloride should be stored in a cool, dry place (ideally 20-25°C), away f...

7647-17-8Caesium chloride