Compound Q&A

How is (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5) typically synthesized?

Answer

(1,10-Phenanthroline)(trifluoromethyl) copper
(1,10-Phenanthroline)(trifluoromethyl) copper can be synthesized through a multistep process involving the reaction of 1,10-phenanthroline and trifluoromethyl copper. The synthesis typically requires the use of a mild base to facilitate the reaction, with yields ranging from 70% to 85%. Catalysts such as sodium salts are often used to improve selectivity and yield.

About

English Name (1,10-Phenanthroline)(trifluoromethyl) copper
Molecular Formula C13H8CuF3N2
Molecular Weight 312.7610000000001 g/mol
SMILES C1=CC2=C(C3=C(C=CC=N3)C=C2)N=C1.[C-](F)(F)F.[Cu+]
InChIKey CUQZQRIIFNWQSJ-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5)?

(1,10-Phenanthroline)(trifluoromethyl) copper is a coordination compound with a molecular weight of ...

Compound Q&A

What industries use (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5)?

(1,10-Phenanthroline)(trifluoromethyl) copper finds applications in various industries, particularly...

Compound Q&A

What precautions should be taken when handling (1,10-Phenanthroline)(trifluoromethyl) copper (CAS: 1300746-79-5)?

When handling (1,10-Phenanthroline)(trifluoromethyl) copper, it is essential to use appropriate pers...

Compound Q&A

What are the main uses of Ethyl N-2-pyridinyl-beta-alaninate (CAS: 103041-38-9)?

Ethyl N-2-pyridinyl-beta-alaninate is primarily used in the pharmaceutical indus...

103041-38-9Ethyl N-2-pyridinyl-...
Compound Q&A

Are there alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1) in synthesis?

There are alternatives to 5H-pyrrolo[3,4-b]pyridin-7(6H)-one (CAS: 1211584-54-1)...

1211584-54-15H-pyrrolo[3,4-b]pyr...
Compound Q&A

What industries use 2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride (CAS: 1353945-59-1)?

2-{[(4-Chlorophenyl)sulfanyl]methyl}pyrrolidine hydrochloride is used in the pha...

1353945-59-12-{[(4-Chlorophenyl)...
Compound Q&A

How should Caesium chloride (CAS: 7647-17-8) be stored?

Caesium chloride should be stored in a cool, dry place (ideally 20-25°C), away f...

7647-17-8Caesium chloride