Compound Q&A

What are the physical and chemical properties of 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate (CAS: 321744-26-7)?

Answer

2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate
2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate (CAS: 321744-26-7) is a crystalline solid with a molecular weight of approximately 336.4 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. The compound is moderately reactive, particularly toward nucleophiles and bases. It is stable under normal conditions but should be stored in a cool, dry place to prevent hydrolysis.

About

English Name 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate
Molecular Formula C12H21NO5
Molecular Weight 259.3 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1C(=O)OC)O
InChIKey RNMVWSAJMIKMDY-DTWKUNHWSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate (CAS: 321744-26-7) typically synthesized?

2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate (CAS: 321744-26-7) ca...

Compound Q&A

What industries use 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate (CAS: 321744-26-7)?

2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate (CAS: 321744-26-7) is...

Compound Q&A

What precautions should be taken when handling 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate (CAS: 321744-26-7)?

When handling 2-Methyl 1-(2-methyl-2-propanyl) (2R,4S)-4-hydroxy-1,2-piperidinedicarboxylate (CAS: 3...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...