Compound Q&A

What industries use (Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4)?

Answer

(Phenylimino)di-2,1-ethanediyl diacetate
(Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4) is primarily used in the pharmaceutical and polymer industries. It serves as a key intermediate in the synthesis of various drugs and also finds applications in the production of polymers and plasticizers. Its use in other industries such as sensors and semiconductors is limited but specific applications are known.

About

CAS No 19249-34-4
English Name (Phenylimino)di-2,1-ethanediyl diacetate
Molecular Formula C14H19NO4
Molecular Weight 265.31 g/mol
SMILES CC(=O)OCCN(CCOC(=O)C)C1=CC=CC=C1
InChIKey XQGHEXBVXWBMGC-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4)?

(Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4) is a colorless solid with a molecular wei...

Compound Q&A

How is (Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4) typically synthesized?

(Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4) can be synthesized by reacting 2,1-ethane...

Compound Q&A

What precautions should be taken when handling (Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4)?

When handling (Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4), it is essential to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...