Compound Q&A

What are the physical and chemical properties of (Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4)?

Answer

(Phenylimino)di-2,1-ethanediyl diacetate
(Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4) is a colorless solid with a molecular weight of approximately 236.26 g/mol. It has a low solubility in water but is more soluble in organic solvents like acetone and ethanol. This compound is relatively stable under normal conditions but can react with strong bases. It is used in the synthesis of other organic compounds and as an intermediate in various chemical processes.

About

CAS No 19249-34-4
English Name (Phenylimino)di-2,1-ethanediyl diacetate
Molecular Formula C14H19NO4
Molecular Weight 265.31 g/mol
SMILES CC(=O)OCCN(CCOC(=O)C)C1=CC=CC=C1
InChIKey XQGHEXBVXWBMGC-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is (Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4) typically synthesized?

(Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4) can be synthesized by reacting 2,1-ethane...

Compound Q&A

What industries use (Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4)?

(Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4) is primarily used in the pharmaceutical a...

Compound Q&A

What precautions should be taken when handling (Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4)?

When handling (Phenylimino)di-2,1-ethanediyl diacetate (CAS: 19249-34-4), it is essential to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...