Compound Q&A

What precautions should be taken when handling 3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1)?

Answer

3,5-Dichloro-2-nitropyridine
Proper handling of 3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1) requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a fume hood to avoid inhalation. Spills should be cleaned up immediately, and the Safety Data Sheet (SDS) should be consulted for detailed spill procedures. Ensure proper storage and disposal according to local regulations.

About

English Name 3,5-Dichloro-2-nitropyridine
Molecular Formula C5H2Cl2N2O2
Molecular Weight 192.99 g/mol
SMILES Clc1cnc(c(c1)Cl)[N+](=O)[O-]
InChIKey ACHMQFKFXAKDAH-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1)?

3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1) is a crystalline solid with a molecular weight of 22...

Compound Q&A

How is 3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1) typically synthesized?

3,5-Dichloro-2-nitropyridine is typically synthesized by the nitration of 3,5-dichloropyridine. This...

Compound Q&A

What industries use 3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1)?

3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1) is used in the pharmaceutical industry for the synth...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...