Compound Q&A

What industries use 3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1)?

Answer

3,5-Dichloro-2-nitropyridine
3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1) is used in the pharmaceutical industry for the synthesis of certain drug intermediates. It also finds applications in the production of sensors and as a precursor in the polymer industry. Its reactivity makes it useful in various chemical processes.

About

English Name 3,5-Dichloro-2-nitropyridine
Molecular Formula C5H2Cl2N2O2
Molecular Weight 192.99 g/mol
SMILES Clc1cnc(c(c1)Cl)[N+](=O)[O-]
InChIKey ACHMQFKFXAKDAH-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1)?

3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1) is a crystalline solid with a molecular weight of 22...

Compound Q&A

How is 3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1) typically synthesized?

3,5-Dichloro-2-nitropyridine is typically synthesized by the nitration of 3,5-dichloropyridine. This...

Compound Q&A

What precautions should be taken when handling 3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1)?

Proper handling of 3,5-Dichloro-2-nitropyridine (CAS: 610278-88-1) requires the use of personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...