Compound Q&A

What precautions should be taken when handling (2-Chloro-6-fluorophenyl)hydrazine hydrochloride (CAS: 529512-79-6)?

Answer

(2-Chloro-6-fluorophenyl)hydrazine hydrochloride
When handling (2-Chloro-6-fluorophenyl)hydrazine hydrochloride, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. The compound should be stored in a fume hood to minimize exposure to vapors. In case of spills, the area should be ventilated, and the spill should be cleaned up using an appropriate absorbent. Always refer to the Safety Data Sheet (SDS) for detailed safety information.

About

English Name (2-Chloro-6-fluorophenyl)hydrazine hydrochloride
Molecular Formula C6H7Cl2FN2
Molecular Weight 197.04 g/mol
SMILES C1=CC(=C(C(=C1)Cl)NN)F.Cl
InChIKey IMIGJFNGDJQHMS-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Chloro-6-fluorophenyl)hydrazine hydrochloride (CAS: 529512-79-6)?

(2-Chloro-6-fluorophenyl)hydrazine hydrochloride is a crystalline solid with a molecular weight of a...

Compound Q&A

How is (2-Chloro-6-fluorophenyl)hydrazine hydrochloride (CAS: 529512-79-6) typically synthesized?

(2-Chloro-6-fluorophenyl)hydrazine hydrochloride is often synthesized by reacting 2-chloro-6-fluorop...

Compound Q&A

What industries use (2-Chloro-6-fluorophenyl)hydrazine hydrochloride (CAS: 529512-79-6)?

(2-Chloro-6-fluorophenyl)hydrazine hydrochloride finds applications in pharmaceutical industries for...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...