Compound Q&A

What are the physical and chemical properties of (2-Chloro-6-fluorophenyl)hydrazine hydrochloride (CAS: 529512-79-6)?

Answer

(2-Chloro-6-fluorophenyl)hydrazine hydrochloride
(2-Chloro-6-fluorophenyl)hydrazine hydrochloride is a crystalline solid with a molecular weight of approximately 244.58 g/mol. It is slightly soluble in water and more soluble in organic solvents like ethanol and acetone. The compound shows basic properties due to the presence of the hydrazine group and can react with acids to form salts. It is less reactive compared to other aromatic hydrazines.

About

English Name (2-Chloro-6-fluorophenyl)hydrazine hydrochloride
Molecular Formula C6H7Cl2FN2
Molecular Weight 197.04 g/mol
SMILES C1=CC(=C(C(=C1)Cl)NN)F.Cl
InChIKey IMIGJFNGDJQHMS-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is (2-Chloro-6-fluorophenyl)hydrazine hydrochloride (CAS: 529512-79-6) typically synthesized?

(2-Chloro-6-fluorophenyl)hydrazine hydrochloride is often synthesized by reacting 2-chloro-6-fluorop...

Compound Q&A

What industries use (2-Chloro-6-fluorophenyl)hydrazine hydrochloride (CAS: 529512-79-6)?

(2-Chloro-6-fluorophenyl)hydrazine hydrochloride finds applications in pharmaceutical industries for...

Compound Q&A

What precautions should be taken when handling (2-Chloro-6-fluorophenyl)hydrazine hydrochloride (CAS: 529512-79-6)?

When handling (2-Chloro-6-fluorophenyl)hydrazine hydrochloride, appropriate personal protective equi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...