Compound Q&A

What precautions should be taken when handling 5-Bromo-2-pyrazol-1-yl-pyrimidine (CAS: 883230-94-2)?

Answer

5-Bromo-2-pyrazol-1-yl-pyrimidine
When handling 5-Bromo-2-pyrazol-1-yl-pyrimidine, ensure the use of personal protective equipment (PPE) such as gloves, safety glasses, and a lab coat. Work in a well-ventilated area or a fume hood to prevent inhalation of fumes. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be properly decontaminated. Always refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

English Name 5-Bromo-2-pyrazol-1-yl-pyrimidine
Molecular Formula C7H5BrN4
Molecular Weight 225.05 g/mol
SMILES C1=CN(N=C1)C2=NC=C(C=N2)Br
InChIKey XQBZYQWGCLJVAF-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-pyrazol-1-yl-pyrimidine (CAS: 883230-94-2)?

5-Bromo-2-pyrazol-1-yl-pyrimidine is a crystalline compound with a molecular weight of approximately...

Compound Q&A

How is 5-Bromo-2-pyrazol-1-yl-pyrimidine (CAS: 883230-94-2) typically synthesized?

5-Bromo-2-pyrazol-1-yl-pyrimidine is typically synthesized through a multistep reaction starting fro...

Compound Q&A

What industries use 5-Bromo-2-pyrazol-1-yl-pyrimidine (CAS: 883230-94-2)?

5-Bromo-2-pyrazol-1-yl-pyrimidine is primarily used in the pharmaceutical industry as an intermediat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...