Compound Q&A

Is (1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid (CAS: 882562-39-2) safe?

Answer

{1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid
The compound is generally considered safe when handled according to standard safety guidelines. However, it should be used with caution due to its potential reactivity. Protective measures include wearing appropriate personal protective equipment and ensuring proper ventilation during handling.

About

English Name {1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid
Molecular Formula C14H13BN2O4S
Molecular Weight 316.15 g/mol
SMILES B(C1=CN(C2=C1C=CC=N2)S(=O)(=O)C3=CC=C(C=C3)C)(O)O
InChIKey ZJMVMHYCONCGCX-UHFFFAOYSA-N
Last Updated: 2025-11-07 07:51

Related Q&A

Compound Q&A

What is (1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid (CAS: 882562-39-2)?

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid is a boronic acid derivative...

Compound Q&A

What are the main uses of (1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid (CAS: 882562-39-2)?

This compound is primarily used in organic synthesis as a boronic acid precursor, particularly in Su...

Compound Q&A

How should (1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid (CAS: 882562-39-2) be stored?

Store this compound in a cool, dark place at room temperature to prevent degradation. Use airtight c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...