Compound Q&A

What are the main uses of (1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid (CAS: 882562-39-2)?

Answer

{1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid
This compound is primarily used in organic synthesis as a boronic acid precursor, particularly in Suzuki couplings and other coupling reactions. It also shows potential in drug discovery and development due to its unique chemical structure.

About

English Name {1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid
Molecular Formula C14H13BN2O4S
Molecular Weight 316.15 g/mol
SMILES B(C1=CN(C2=C1C=CC=N2)S(=O)(=O)C3=CC=C(C=C3)C)(O)O
InChIKey ZJMVMHYCONCGCX-UHFFFAOYSA-N
Last Updated: 2025-11-07 07:51

Related Q&A

Compound Q&A

What is (1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid (CAS: 882562-39-2)?

1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid is a boronic acid derivative...

Compound Q&A

Is (1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid (CAS: 882562-39-2) safe?

The compound is generally considered safe when handled according to standard safety guidelines. Howe...

Compound Q&A

How should (1-[(4-Methylphenyl)sulfonyl]-1H-pyrrolo[2,3-b]pyridin-3-yl}boronic acid (CAS: 882562-39-2) be stored?

Store this compound in a cool, dark place at room temperature to prevent degradation. Use airtight c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...