Compound Q&A

What are the main uses of (4-Bromo-2-nitrophenyl)acetic acid (CAS: 6127-11-3)?

Answer

(4-Bromo-2-nitrophenyl)acetic acid
(4-Bromo-2-nitrophenyl)acetic acid is primarily used in the pharmaceutical industry for synthesizing intermediates. It also finds applications in research, particularly in medicinal chemistry and drug development, due to its functional groups that enable various chemical reactions.

About

CAS No 6127-11-3
English Name (4-Bromo-2-nitrophenyl)acetic acid
Molecular Formula C8H6BrNO4
Molecular Weight 260.04 g/mol
SMILES OC(=O)Cc1ccc(Br)cc1[N+](=O)[O-]
InChIKey LBZPHZBNFDOCCR-UHFFFAOYSA-N
Last Updated: 2025-11-06 11:25

Related Q&A

Compound Q&A

What is (4-Bromo-2-nitrophenyl)acetic acid (CAS: 6127-11-3)?

(4-Bromo-2-nitrophenyl)acetic acid is a chemical compound with the CAS number 6127-11-3. It features...

Compound Q&A

Is (4-Bromo-2-nitrophenyl)acetic acid (CAS: 6127-11-3) safe?

(4-Bromo-2-nitrophenyl)acetic acid is generally considered safe when handled with appropriate protec...

Compound Q&A

How should (4-Bromo-2-nitrophenyl)acetic acid (CAS: 6127-11-3) be stored?

(4-Bromo-2-nitrophenyl)acetic acid should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...