Compound Q&A

What is (4-Bromo-2-nitrophenyl)acetic acid (CAS: 6127-11-3)?

Answer

(4-Bromo-2-nitrophenyl)acetic acid
(4-Bromo-2-nitrophenyl)acetic acid is a chemical compound with the CAS number 6127-11-3. It features a phenolic ring with a bromine atom and a nitro group, and an acetic acid side chain. This compound is used in various applications including pharmaceuticals and research for its unique chemical properties.

About

CAS No 6127-11-3
English Name (4-Bromo-2-nitrophenyl)acetic acid
Molecular Formula C8H6BrNO4
Molecular Weight 260.04 g/mol
SMILES OC(=O)Cc1ccc(Br)cc1[N+](=O)[O-]
InChIKey LBZPHZBNFDOCCR-UHFFFAOYSA-N
Last Updated: 2025-11-06 11:25

Related Q&A

Compound Q&A

What are the main uses of (4-Bromo-2-nitrophenyl)acetic acid (CAS: 6127-11-3)?

(4-Bromo-2-nitrophenyl)acetic acid is primarily used in the pharmaceutical industry for synthesizing...

Compound Q&A

Is (4-Bromo-2-nitrophenyl)acetic acid (CAS: 6127-11-3) safe?

(4-Bromo-2-nitrophenyl)acetic acid is generally considered safe when handled with appropriate protec...

Compound Q&A

How should (4-Bromo-2-nitrophenyl)acetic acid (CAS: 6127-11-3) be stored?

(4-Bromo-2-nitrophenyl)acetic acid should be stored in a cool, dry place away from direct sunlight a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...