Compound Q&A

Is (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine (CAS: 1345413-20-8) safe?

Answer

(1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine
When handled properly, (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine is generally considered safe. However, it is important to follow all safety guidelines, including wearing protective gloves and goggles, and ensuring adequate ventilation. Proper storage and handling are essential to minimize any potential risks.

About

English Name (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine
Molecular Formula C9H9F2N
Molecular Weight 169.17 g/mol
SMILES N[C@H]1C[C@@H]1c1ccc(c(c1)F)F
InChIKey QVUBIQNXHRPJKK-MUWHJKNJSA-N
Last Updated: 2025-11-06 11:25

Related Q&A

Compound Q&A

What is (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine (CAS: 1345413-20-8)?

(1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine is a cyclic amine derivative with a unique molecul...

Compound Q&A

What are the main uses of (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine (CAS: 1345413-20-8)?

(1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine is primarily used as a building block in pharmaceu...

Compound Q&A

How should (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine (CAS: 1345413-20-8) be stored?

(1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine should be stored in a cool, dry place protected fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...