Compound Q&A

What are the main uses of (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine (CAS: 1345413-20-8)?

Answer

(1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine
(1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine is primarily used as a building block in pharmaceuticals and fine chemicals. It serves as a precursor for the synthesis of various medicinally active compounds and can be employed in research for developing new drug candidates. Additionally, it may find applications in materials science and other specialized industries.

About

English Name (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine
Molecular Formula C9H9F2N
Molecular Weight 169.17 g/mol
SMILES N[C@H]1C[C@@H]1c1ccc(c(c1)F)F
InChIKey QVUBIQNXHRPJKK-MUWHJKNJSA-N
Last Updated: 2025-11-06 11:25

Related Q&A

Compound Q&A

What is (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine (CAS: 1345413-20-8)?

(1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine is a cyclic amine derivative with a unique molecul...

Compound Q&A

Is (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine (CAS: 1345413-20-8) safe?

When handled properly, (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine is generally considered saf...

Compound Q&A

How should (1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine (CAS: 1345413-20-8) be stored?

(1S,2R)-2-(3,4-difluorophenyl)cyclopropan-1-amine should be stored in a cool, dry place protected fr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...