Compound Q&A

How should Irbesartan-d4 (CAS: 1216883-23-6) be stored?

Answer

Irbesartan-d4
Irbesartan-d4 should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to protect it from moisture and air. The storage temperature should not exceed 25°C to maintain its stability and purity.

About

English Name Irbesartan-d4
Molecular Formula C25H24D4N6O
Molecular Weight 432.56 g/mol
SMILES CCCCC1=NC2(C(=O)N1Cc1c([2H])c([2H])c(c(c1[2H])[2H])c1ccccc1c1nnn[nH]1)CCCC2
InChIKey YOSHYTLCDANDAN-WQKXEYJYSA-N
Last Updated: 2025-11-06 11:25

Related Q&A

Compound Q&A

What is Irbesartan-d4 (CAS: 1216883-23-6)?

Irbesartan-d4 is a chemical compound used as a stable isotope-labeled internal standard in the analy...

Compound Q&A

What are the main uses of Irbesartan-d4 (CAS: 1216883-23-6)?

Irbesartan-d4 is primarily used as an internal standard in analytical chemistry for the quantificati...

Compound Q&A

Is Irbesartan-d4 (CAS: 1216883-23-6) safe?

Irbesartan-d4 is generally considered safe for its intended use in analytical chemistry. However, it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...