Compound Q&A

What are the main uses of Irbesartan-d4 (CAS: 1216883-23-6)?

Answer

Irbesartan-d4
Irbesartan-d4 is primarily used as an internal standard in analytical chemistry for the quantification of irbesartan in various biological matrices. It is essential for accurate and reliable measurement in pharmaceutical research and quality control processes.

About

English Name Irbesartan-d4
Molecular Formula C25H24D4N6O
Molecular Weight 432.56 g/mol
SMILES CCCCC1=NC2(C(=O)N1Cc1c([2H])c([2H])c(c(c1[2H])[2H])c1ccccc1c1nnn[nH]1)CCCC2
InChIKey YOSHYTLCDANDAN-WQKXEYJYSA-N
Last Updated: 2025-11-06 11:25

Related Q&A

Compound Q&A

What is Irbesartan-d4 (CAS: 1216883-23-6)?

Irbesartan-d4 is a chemical compound used as a stable isotope-labeled internal standard in the analy...

Compound Q&A

Is Irbesartan-d4 (CAS: 1216883-23-6) safe?

Irbesartan-d4 is generally considered safe for its intended use in analytical chemistry. However, it...

Compound Q&A

How should Irbesartan-d4 (CAS: 1216883-23-6) be stored?

Irbesartan-d4 should be stored in a cool, dry place away from direct sunlight and heat sources. It s...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...