Compound Q&A

What industries use 5-Hydroxy Diclofenac (CAS: 69002-84-2)?

Answer

5-Hydroxy Diclofenac
5-Hydroxy Diclofenac (CAS: 69002-84-2) is primarily used in the pharmaceutical industry for the development of anti-inflammatory and analgesic drugs. It is also explored in research for its potential use in other applications such as polymer synthesis and sensor technology.

About

CAS No 69002-84-2
English Name 5-Hydroxy Diclofenac
Molecular Formula C14H11Cl2NO3
Molecular Weight 312.1 g/mol
SMILES C1=CC(=C(C(=C1)Cl)NC2=C(C=C(C=C2)O)CC(=O)O)Cl
InChIKey VNQURRWYKFZKJZ-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Hydroxy Diclofenac (CAS: 69002-84-2)?

5-Hydroxy Diclofenac (CAS: 69002-84-2) is a white to off-white crystalline solid with a molecular we...

Compound Q&A

How is 5-Hydroxy Diclofenac (CAS: 69002-84-2) typically synthesized?

5-Hydroxy Diclofenac (CAS: 69002-84-2) is synthesized by the reduction of 2,3-dichlorobenzoic acid w...

Compound Q&A

What precautions should be taken when handling 5-Hydroxy Diclofenac (CAS: 69002-84-2)?

When handling 5-Hydroxy Diclofenac (CAS: 69002-84-2), it is essential to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...