Compound Q&A

What industries use 2-(4-Fluorophenyl)-2-methylpropanoic acid (CAS: 93748-19-7)?

Answer

2-(4-Fluorophenyl)-2-methylpropanoic acid
2-(4-Fluorophenyl)-2-methylpropanoic acid is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various medications. It also finds applications in the polymer industry for enhancing certain properties of polymers, and in sensor technology for specific chemical detection due to its fluorophore functionality.

About

CAS No 93748-19-7
English Name 2-(4-Fluorophenyl)-2-methylpropanoic acid
Molecular Formula C10H11FO2
Molecular Weight 182.19 g/mol
SMILES CC(C)(C1=CC=C(C=C1)F)C(=O)O
InChIKey IOSAIRIBZLAABD-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Fluorophenyl)-2-methylpropanoic acid (CAS: 93748-19-7)?

2-(4-Fluorophenyl)-2-methylpropanoic acid is a white to off-white crystalline solid with a molecular...

Compound Q&A

How is 2-(4-Fluorophenyl)-2-methylpropanoic acid (CAS: 93748-19-7) typically synthesized?

2-(4-Fluorophenyl)-2-methylpropanoic acid is synthesized through a multistep process involving Fried...

Compound Q&A

What precautions should be taken when handling 2-(4-Fluorophenyl)-2-methylpropanoic acid (CAS: 93748-19-7)?

When handling 2-(4-Fluorophenyl)-2-methylpropanoic acid, it is essential to wear adequate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...