Compound Q&A

How is 2-(4-Fluorophenyl)-2-methylpropanoic acid (CAS: 93748-19-7) typically synthesized?

Answer

2-(4-Fluorophenyl)-2-methylpropanoic acid
2-(4-Fluorophenyl)-2-methylpropanoic acid is synthesized through a multistep process involving Friedel-Crafts alkylation and subsequent hydrolysis. Commonly, methylbenzene is treated with benzoyl chloride in the presence of aluminum chloride to form benzoylmethylbenzene. Further processing, including hydrogen fluoride mediation, yields the fluoro derivative, which is then hydrolyzed to obtain the desired acid.

About

CAS No 93748-19-7
English Name 2-(4-Fluorophenyl)-2-methylpropanoic acid
Molecular Formula C10H11FO2
Molecular Weight 182.19 g/mol
SMILES CC(C)(C1=CC=C(C=C1)F)C(=O)O
InChIKey IOSAIRIBZLAABD-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Fluorophenyl)-2-methylpropanoic acid (CAS: 93748-19-7)?

2-(4-Fluorophenyl)-2-methylpropanoic acid is a white to off-white crystalline solid with a molecular...

Compound Q&A

What industries use 2-(4-Fluorophenyl)-2-methylpropanoic acid (CAS: 93748-19-7)?

2-(4-Fluorophenyl)-2-methylpropanoic acid is primarily used in the pharmaceutical industry as an int...

Compound Q&A

What precautions should be taken when handling 2-(4-Fluorophenyl)-2-methylpropanoic acid (CAS: 93748-19-7)?

When handling 2-(4-Fluorophenyl)-2-methylpropanoic acid, it is essential to wear adequate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...