Compound Q&A

What precautions should be taken when handling (6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol (CAS: 68131-40-8)?

Answer

(6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol
When handling this compound, wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Store it in a cool, dry place away from direct sunlight and heat sources. Use a fume hood during preparation and disposal. Always refer to the Safety Data Sheet (SDS) for specific handling and disposal instructions.

About

CAS No 68131-40-8
English Name (6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol
Molecular Formula C21H27D3O2
Molecular Weight 317.49 g/mol
EINECS 614-295-4
SMILES [2H]C([2H])([2H])CCCCc2cc1OC([C@@H]3CC/C(=C\[C@H]3c1c(O)c2)C)(C)C
InChIKey CYQFCXCEBYINGO-MVOYJBSWSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol (CAS: 68131-40-8)?

The compound is a crystalline solid with a molecular weight of approximately 389.48 g/mol. It has lo...

Compound Q&A

How is (6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol (CAS: 68131-40-8) typically synthesized?

This compound is typically synthesized via a condensation reaction of a substituted aromatic ring wi...

Compound Q&A

What industries use (6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol (CAS: 68131-40-8)?

This compound finds applications in the pharmaceutical industry due to its unique chemical structure...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...