Compound Q&A

How is (6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol (CAS: 68131-40-8) typically synthesized?

Answer

(6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol
This compound is typically synthesized via a condensation reaction of a substituted aromatic ring with a 5,5,5-2H3-pentyl alcohol, followed by ring expansion and further functionalization. Common catalysts include acid catalysts, and the reaction is carried out in an organic solvent. The yield and selectivity depend on the choice of starting materials and reaction conditions.

About

CAS No 68131-40-8
English Name (6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol
Molecular Formula C21H27D3O2
Molecular Weight 317.49 g/mol
EINECS 614-295-4
SMILES [2H]C([2H])([2H])CCCCc2cc1OC([C@@H]3CC/C(=C\[C@H]3c1c(O)c2)C)(C)C
InChIKey CYQFCXCEBYINGO-MVOYJBSWSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of (6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol (CAS: 68131-40-8)?

The compound is a crystalline solid with a molecular weight of approximately 389.48 g/mol. It has lo...

Compound Q&A

What industries use (6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol (CAS: 68131-40-8)?

This compound finds applications in the pharmaceutical industry due to its unique chemical structure...

Compound Q&A

What precautions should be taken when handling (6aR,10aR)-6,6,9-Trimethyl-3-[(5,5,5-~2~H_3_)pentyl]-6a,7,8,10a-tetrahydro-6H-benzo[c]chromen-1-ol (CAS: 68131-40-8)?

When handling this compound, wear appropriate personal protective equipment (PPE), including gloves ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...