Compound Q&A

What industries use 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone (CAS: 1256578-99-0)?

Answer

6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone
6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone is primarily used in the pharmaceutical industry for the synthesis of various organic compounds. It is also utilized in the polymer industry for the development of new materials with specific properties. Additionally, it has potential applications in the sensor and semiconductor industries.

About

English Name 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone
Molecular Formula C13H15BrO2
Molecular Weight 283.16 g/mol
SMILES COc1cc2c(cc1Br)CCC(=O)C2(C)C
InChIKey BCYSBQVQSCOMEH-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone (CAS: 1256578-99-0)?

6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone is a crystalline compound with a mole...

Compound Q&A

How is 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone (CAS: 1256578-99-0) typically synthesized?

6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone can be synthesized via a multistep pr...

Compound Q&A

What precautions should be taken when handling 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone (CAS: 1256578-99-0)?

When handling 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone, it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...