Compound Q&A

How is 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone (CAS: 1256578-99-0) typically synthesized?

Answer

6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone
6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone can be synthesized via a multistep process involving bromination and methylation reactions of naphthalene. The process typically requires the use of bromine and methyl iodide as reagents. The yield and selectivity of the reaction can be optimized using specific catalysts and reaction conditions.

About

English Name 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone
Molecular Formula C13H15BrO2
Molecular Weight 283.16 g/mol
SMILES COc1cc2c(cc1Br)CCC(=O)C2(C)C
InChIKey BCYSBQVQSCOMEH-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone (CAS: 1256578-99-0)?

6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone is a crystalline compound with a mole...

Compound Q&A

What industries use 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone (CAS: 1256578-99-0)?

6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone (CAS: 1256578-99-0)?

When handling 6-Bromo-7-methoxy-1,1-dimethyl-3,4-dihydro-2(1H)-naphthalenone, it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...