Compound Q&A

What industries use 2-(2,4-Dibromophenyl)acetic acid (CAS: 98434-44-7)?

Answer

2-(2,4-Dibromophenyl)acetic acid
2-(2,4-Dibromophenyl)acetic acid finds applications in the pharmaceutical industry for the production of certain drugs. It is also used in the synthesis of organic compounds and as an intermediate in the manufacturing of functional materials such as polymers and sensors.

About

CAS No 98434-44-7
English Name 2-(2,4-Dibromophenyl)acetic acid
Molecular Formula C8H6Br2O2
Molecular Weight 293.94 g/mol
SMILES C1=CC(=C(C=C1Br)Br)CC(=O)O
InChIKey FOTKDKHMRQKYHB-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2,4-Dibromophenyl)acetic acid (CAS: 98434-44-7)?

2-(2,4-Dibromophenyl)acetic acid is a white crystalline solid with a high molecular weight. It has a...

Compound Q&A

How is 2-(2,4-Dibromophenyl)acetic acid (CAS: 98434-44-7) typically synthesized?

2-(2,4-Dibromophenyl)acetic acid is typically synthesized by bromination of 2,4-dihydroxybenzoic aci...

Compound Q&A

What precautions should be taken when handling 2-(2,4-Dibromophenyl)acetic acid (CAS: 98434-44-7)?

Proper personal protective equipment (PPE) such as gloves and safety goggles should be worn when han...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...