Compound Q&A

What are the physical and chemical properties of 2-(2,4-Dibromophenyl)acetic acid (CAS: 98434-44-7)?

Answer

2-(2,4-Dibromophenyl)acetic acid
2-(2,4-Dibromophenyl)acetic acid is a white crystalline solid with a high molecular weight. It has a low solubility in water and ethanol. Chemically, it is less reactive than other brominated compounds but reacts readily with bases. Its molecular weight is approximately 348.04 g/mol.

About

CAS No 98434-44-7
English Name 2-(2,4-Dibromophenyl)acetic acid
Molecular Formula C8H6Br2O2
Molecular Weight 293.94 g/mol
SMILES C1=CC(=C(C=C1Br)Br)CC(=O)O
InChIKey FOTKDKHMRQKYHB-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is 2-(2,4-Dibromophenyl)acetic acid (CAS: 98434-44-7) typically synthesized?

2-(2,4-Dibromophenyl)acetic acid is typically synthesized by bromination of 2,4-dihydroxybenzoic aci...

Compound Q&A

What industries use 2-(2,4-Dibromophenyl)acetic acid (CAS: 98434-44-7)?

2-(2,4-Dibromophenyl)acetic acid finds applications in the pharmaceutical industry for the productio...

Compound Q&A

What precautions should be taken when handling 2-(2,4-Dibromophenyl)acetic acid (CAS: 98434-44-7)?

Proper personal protective equipment (PPE) such as gloves and safety goggles should be worn when han...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...