Compound Q&A

What are the physical and chemical properties of 4-[(E)-Benzylideneamino]phenol (CAS: 588-53-4)?

Answer

4-[(E)-Benzylideneamino]phenol
4-[(E)-Benzylideneamino]phenol is a white crystalline solid with a molecular weight of approximately 236.25 g/mol. It has a melting point of 132-134°C and is slightly soluble in water. This compound exhibits basic properties due to the amino group and can engage in nucleophilic substitution reactions. It is also known for its potential to undergo hydrolysis and condensation reactions.

About

CAS No 588-53-4
English Name 4-[(E)-Benzylideneamino]phenol
Molecular Formula C13H11NO
Molecular Weight 197.24 g/mol
SMILES C1=CC=C(C=C1)C=NC2=CC=C(C=C2)O
InChIKey BVTLIIQDQAUXOI-GXDHUFHOSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is 4-[(E)-Benzylideneamino]phenol (CAS: 588-53-4) typically synthesized?

4-[(E)-Benzylideneamino]phenol is commonly synthesized via the condensation of benzaldehyde and phen...

Compound Q&A

What industries use 4-[(E)-Benzylideneamino]phenol (CAS: 588-53-4)?

4-[(E)-Benzylideneamino]phenol is used in various industries due to its chemical properties. It is e...

Compound Q&A

What precautions should be taken when handling 4-[(E)-Benzylideneamino]phenol (CAS: 588-53-4)?

When handling 4-[(E)-Benzylideneamino]phenol (CAS: 588-53-4), it is essential to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...