Compound Q&A

What precautions should be taken when handling Benzyl (2R)-2-cyano-1-pyrrolidinecarboxylate (CAS: 620601-77-6)?

Answer

Benzyl (2R)-2-cyano-1-pyrrolidinecarboxylate
When handling Benzyl (2R)-2-cyano-1-pyrrolidinecarboxylate (CAS: 620601-77-6), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. The compound should be handled in a fume hood due to its volatility. Spills should be cleaned up immediately using absorbent materials, and the area should be well-ventilated. For more detailed safety information, refer to the Material Safety Data Sheet (MSDS) or Safety Data Sheet (SDS).

About

English Name Benzyl (2R)-2-cyano-1-pyrrolidinecarboxylate
Molecular Formula C13H14N2O2
Molecular Weight 219.28 g/mol
SMILES C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C#N
InChIKey AUVGQGIWVNDVSL-GFCCVEGCSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzyl (2R)-2-cyano-1-pyrrolidinecarboxylate (CAS: 620601-77-6)?

Benzyl (2R)-2-cyano-1-pyrrolidinecarboxylate (CAS: 620601-77-6) is a crystalline solid with a molecu...

Compound Q&A

How is Benzyl (2R)-2-cyano-1-pyrrolidinecarboxylate (CAS: 620601-77-6) typically synthesized?

Benzyl (2R)-2-cyano-1-pyrrolidinecarboxylate is typically synthesized via the reaction of benzyl bro...

Compound Q&A

What industries use Benzyl (2R)-2-cyano-1-pyrrolidinecarboxylate (CAS: 620601-77-6)?

Benzyl (2R)-2-cyano-1-pyrrolidinecarboxylate (CAS: 620601-77-6) is primarily used in the pharmaceuti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...