Compound Q&A

What industries use 2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8)?

Answer

2-(2-Nitrophenyl)ethanamine hydrochloride (1:1)
2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8) is primarily used in the pharmaceutical industry for its role as a precursor in the synthesis of various pharmaceutical compounds. It also finds applications in the polymer industry, where it serves as a component in certain polymer formulations. Additionally, it is utilized in the development of sensors and semiconductors for its unique chemical properties.

About

English Name 2-(2-Nitrophenyl)ethanamine hydrochloride (1:1)
Molecular Formula C8H11ClN2O2
Molecular Weight 202.64 g/mol
SMILES Cl.NCCc1ccccc1[N+](=O)[O-]
InChIKey WOSOJVABEIZQDC-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8)?

2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8) is a crystalline solid with a molecular...

Compound Q&A

How is 2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8) typically synthesized?

2-(2-Nitrophenyl)ethanamine hydrochloride is synthesized through a multi-step process involving the ...

Compound Q&A

What precautions should be taken when handling 2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8)?

When handling 2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8), it is important to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...