Compound Q&A

How is 2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8) typically synthesized?

Answer

2-(2-Nitrophenyl)ethanamine hydrochloride (1:1)
2-(2-Nitrophenyl)ethanamine hydrochloride is synthesized through a multi-step process involving the reaction of 2-nitrophenylamine with hydrochloric acid. The key steps include the formation of the amine from the nitro group, followed by the protonation of the amine to form the hydrochloride salt. This reaction is typically carried out in an aqueous medium, with careful control of pH and temperature to ensure selectivity.

About

English Name 2-(2-Nitrophenyl)ethanamine hydrochloride (1:1)
Molecular Formula C8H11ClN2O2
Molecular Weight 202.64 g/mol
SMILES Cl.NCCc1ccccc1[N+](=O)[O-]
InChIKey WOSOJVABEIZQDC-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8)?

2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8) is a crystalline solid with a molecular...

Compound Q&A

What industries use 2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8)?

2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8) is primarily used in the pharmaceutical...

Compound Q&A

What precautions should be taken when handling 2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8)?

When handling 2-(2-Nitrophenyl)ethanamine hydrochloride (CAS: 861337-74-8), it is important to use a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...