Compound Q&A

What industries use 1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9)?

Answer

1-(4-Nitrophenyl)-1H-imidazole
1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9) is used in various industries, including pharmaceuticals for synthesis of certain drugs, sensors for detecting specific chemicals, and as a precursor in polymer synthesis. It also has applications in the semiconductor industry for certain thin-film processes.

About

CAS No 2301-25-9
English Name 1-(4-Nitrophenyl)-1H-imidazole
Molecular Formula C9H7N3O2
Molecular Weight 189.17 g/mol
SMILES C1=CC(=CC=C1N2C=CN=C2)[N+](=O)[O-]
InChIKey PUCOOPJLAXJKOO-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9)?

1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9) is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9) typically synthesized?

1-(4-Nitrophenyl)-1H-imidazole can be synthesized via the condensation of 4-nitrophenyl isocyanate w...

Compound Q&A

What precautions should be taken when handling 1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9)?

When handling 1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...