Compound Q&A

What are the physical and chemical properties of 1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9)?

Answer

1-(4-Nitrophenyl)-1H-imidazole
1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9) is a crystalline solid with a molecular weight of approximately 204.14 g/mol. It is slightly soluble in water and ethanol. Chemically, it is less reactive compared to other imidazoles but shows good reactivity towards nucleophiles. It is stable under normal conditions but is prone to hydrolysis in basic media.

About

CAS No 2301-25-9
English Name 1-(4-Nitrophenyl)-1H-imidazole
Molecular Formula C9H7N3O2
Molecular Weight 189.17 g/mol
SMILES C1=CC(=CC=C1N2C=CN=C2)[N+](=O)[O-]
InChIKey PUCOOPJLAXJKOO-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is 1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9) typically synthesized?

1-(4-Nitrophenyl)-1H-imidazole can be synthesized via the condensation of 4-nitrophenyl isocyanate w...

Compound Q&A

What industries use 1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9)?

1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9) is used in various industries, including pharmaceuti...

Compound Q&A

What precautions should be taken when handling 1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9)?

When handling 1-(4-Nitrophenyl)-1H-imidazole (CAS: 2301-25-9), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...